C23H22F3NO3S — CID 59991084
4-methyl-N-[(2R)-1-phenylmethoxypropan-2-yl]-N-(2,3,4-trifluorophenyl)benzenesulfonamide (PubChem CID 59991084) has the molecular formula C23H22F3NO3S and a molecular weight of 449.49 g/mol. Its IUPAC name is 4-methyl-N-[(2R)-1-phenylmethoxypropan-2-yl]-N-(2,3,4-trifluorophenyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2R)-1-phenylmethoxypropan-2-yl]-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59991084 |
| Molecular Formula | C23H22F3NO3S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 4-methyl-N-[(2R)-1-phenylmethoxypropan-2-yl]-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc(F)c(F)c2F)[C@H](C)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22F3NO3S/c1-16-8-10-19(11-9-16)31(28,29)27(21-13-12-20(24)22(25)23(21)26)17(2)14-30-15-18-6-4-3-5-7-18/h3-13,17H,14-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | BMIAJZFYXFKKMQ-QGZVFWFLSA-N |
| XLogP | 5.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|