C21H22O5S — CID 11696717
(1R,2S,4R,5R)-2-ethenyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-3,6-dioxabicyclo[3.1.0]hexane (PubChem CID 11696717) has the molecular formula C21H22O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is (1R,2S,4R,5R)-2-ethenyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-3,6-dioxabicyclo[3.1.0]hexane.
| Compound Name | (1R,2S,4R,5R)-2-ethenyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-3,6-dioxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 11696717 |
| Molecular Formula | C21H22O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (1R,2S,4R,5R)-2-ethenyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-3,6-dioxabicyclo[3.1.0]hexane |
| SMILES | C=C[C@@H]1O[C@H](COCc2ccccc2)[C@H]2O[C@@]12S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22O5S/c1-3-19-21(27(22,23)17-11-9-15(2)10-12-17)20(26-21)18(25-19)14-24-13-16-7-5-4-6-8-16/h3-12,18-20H,1,13-14H2,2H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | MULIAGCUCKNJFQ-PLACYPQZSA-N |
| XLogP | 3.03 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|