C14H22 — CID 59991567
(1R,3R,6E)-tricyclo[5.5.1.13,10]tetradec-6-ene (PubChem CID 59991567) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (1R,3R,6E)-tricyclo[5.5.1.13,10]tetradec-6-ene.
| Compound Name | (1R,3R,6E)-tricyclo[5.5.1.13,10]tetradec-6-ene |
|---|---|
| PubChem CID | 59991567 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (1R,3R,6E)-tricyclo[5.5.1.13,10]tetradec-6-ene |
| SMILES | C1=C2/CCC3CC[C@@H](C2)C[C@H](CC/1)C3 |
| InChI | InChI=1S/C14H22/c1-2-11-4-5-12-6-7-14(8-11)10-13(3-1)9-12/h2,12-14H,1,3-10H2/b11-2-/t12?,13-,14+/m1/s1 |
| InChIKey | RDENVJMHNPZFCY-AFCCFVCLSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|