C15H24 — CID 18736925
tricyclo[9.3.1.03,8]pentadec-11-ene (PubChem CID 18736925) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is tricyclo[9.3.1.03,8]pentadec-11-ene.
| Compound Name | tricyclo[9.3.1.03,8]pentadec-11-ene |
|---|---|
| PubChem CID | 18736925 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | tricyclo[9.3.1.03,8]pentadec-11-ene |
| SMILES | C1=C2CCC3CCCCC3CC(CC1)C2 |
| InChI | InChI=1S/C15H24/c1-2-7-15-11-13-5-3-4-12(10-13)8-9-14(15)6-1/h4,13-15H,1-3,5-11H2 |
| InChIKey | VKJJKVOCIAWXRL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|