About (2Z)-2-diazopentane
(2Z)-2-diazopentane (PubChem CID 59997940) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is (2Z)-2-diazopentane.
Molecular Properties
| Compound Name | (2Z)-2-diazopentane |
| PubChem CID | 59997940 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | (2Z)-2-diazopentane |
| SMILES | CCCC(C)=[N+]=[N-] |
| InChI | InChI=1S/C5H10N2/c1-3-4-5(2)7-6/h3-4H2,1-2H3 |
| InChIKey | MFWWUZGGBMQULY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-diazopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-diazopentane?
The IUPAC name of (2Z)-2-diazopentane (CID 59997940) is (2Z)-2-diazopentane.
What is the SMILES notation for (2Z)-2-diazopentane?
The canonical SMILES for (2Z)-2-diazopentane is CCCC(C)=[N+]=[N-].
What is the InChIKey of (2Z)-2-diazopentane?
The InChIKey is MFWWUZGGBMQULY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-3-4-5(2)7-6/h3-4H2,1-2H3.
What are the key properties of (2Z)-2-diazopentane?
(2Z)-2-diazopentane has a molecular weight of 98.15 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-diazopentane is sourced from PubChem (CID 59997940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).