C21H25ClN3O3+ — CID 6011567
[4-[(Z)-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]iminomethyl]-2-methoxyphenyl] acetate (PubChem CID 6011567) has the molecular formula C21H25ClN3O3+ and a molecular weight of 402.90 g/mol. Its IUPAC name is [4-[(Z)-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]iminomethyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]iminomethyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 6011567 |
| Molecular Formula | C21H25ClN3O3+ |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [4-[(Z)-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]iminomethyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=N\N2CC[NH+](Cc3ccccc3Cl)CC2)ccc1OC(C)=O |
| InChI | InChI=1S/C21H24ClN3O3/c1-16(26)28-20-8-7-17(13-21(20)27-2)14-23-25-11-9-24(10-12-25)15-18-5-3-4-6-19(18)22/h3-8,13-14H,9-12,15H2,1-2H3/p+1/b23-14- |
| InChIKey | MWLLHDXCLRCYOA-UCQKPKSFSA-O |
| XLogP | 2.01 |
| TPSA | 55.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|