C16H18FN3OS — CID 60529018
6-[2-(butylamino)-1,3-thiazol-4-yl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 60529018) has the molecular formula C16H18FN3OS and a molecular weight of 319.41 g/mol. Its IUPAC name is 6-[2-(butylamino)-1,3-thiazol-4-yl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-(butylamino)-1,3-thiazol-4-yl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 60529018 |
| Molecular Formula | C16H18FN3OS |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-[2-(butylamino)-1,3-thiazol-4-yl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCCCNc1nc(-c2cc3c(cc2F)NC(=O)CC3)cs1 |
| InChI | InChI=1S/C16H18FN3OS/c1-2-3-6-18-16-20-14(9-22-16)11-7-10-4-5-15(21)19-13(10)8-12(11)17/h7-9H,2-6H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | BWKVDESKRRVORR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|