C23H22Cl2N2O4 — CID 60538124
N-[(3,4-dichlorophenyl)methyl]-N-ethyl-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 60538124) has the molecular formula C23H22Cl2N2O4 and a molecular weight of 461.35 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-ethyl-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-ethyl-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 60538124 |
| Molecular Formula | C23H22Cl2N2O4 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-ethyl-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | CCN(Cc1ccc(Cl)c(Cl)c1)C(=O)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C23H22Cl2N2O4/c1-2-26(12-14-5-8-19(24)20(25)10-14)21(28)15-6-7-17-18(11-15)23(30)27(22(17)29)13-16-4-3-9-31-16/h5-8,10-11,16H,2-4,9,12-13H2,1H3 |
| InChIKey | PDCNXZSVPRLTOR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|