C23H22ClN3O3 — CID 60556484
N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-[(2-chlorophenyl)methoxy]benzamide (PubChem CID 60556484) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-[(2-chlorophenyl)methoxy]benzamide.
| Compound Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-[(2-chlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 60556484 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-[(2-chlorophenyl)methoxy]benzamide |
| SMILES | CC(NC(=O)c1ccccc1OCc1ccccc1Cl)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C23H22ClN3O3/c1-15(16-10-12-18(13-11-16)27-23(25)29)26-22(28)19-7-3-5-9-21(19)30-14-17-6-2-4-8-20(17)24/h2-13,15H,14H2,1H3,(H,26,28)(H3,25,27,29) |
| InChIKey | NHDUFXOUEIXRBI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |