C15H16ClN5O3S2 — CID 60563878
N-(2-chloro-5-nitrophenyl)-2-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide (PubChem CID 60563878) has the molecular formula C15H16ClN5O3S2 and a molecular weight of 413.91 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 60563878 |
| Molecular Formula | C15H16ClN5O3S2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nnc(N2CCCC2)s1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H16ClN5O3S2/c1-9(25-15-19-18-14(26-15)20-6-2-3-7-20)13(22)17-12-8-10(21(23)24)4-5-11(12)16/h4-5,8-9H,2-3,6-7H2,1H3,(H,17,22) |
| InChIKey | YOHGMUVMXBWAKK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|