C19H20FN5O3S — CID 60567471
N-(2-fluoro-5-methylsulfonylphenyl)-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide (PubChem CID 60567471) has the molecular formula C19H20FN5O3S and a molecular weight of 417.47 g/mol. Its IUPAC name is N-(2-fluoro-5-methylsulfonylphenyl)-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide.
| Compound Name | N-(2-fluoro-5-methylsulfonylphenyl)-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide |
|---|---|
| PubChem CID | 60567471 |
| Molecular Formula | C19H20FN5O3S |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-(2-fluoro-5-methylsulfonylphenyl)-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide |
| SMILES | CC(C)C(C(=O)Nc1cc(S(C)(=O)=O)ccc1F)n1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H20FN5O3S/c1-12(2)17(25-23-18(22-24-25)13-7-5-4-6-8-13)19(26)21-16-11-14(29(3,27)28)9-10-15(16)20/h4-12,17H,1-3H3,(H,21,26) |
| InChIKey | OXWWWZMEOAYVJC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |