C17H16N2O2S — CID 60585855
(4E)-2-(4-tert-butylphenyl)-4-(1,3-thiazol-4-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 60585855) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is (4E)-2-(4-tert-butylphenyl)-4-(1,3-thiazol-4-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(4-tert-butylphenyl)-4-(1,3-thiazol-4-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 60585855 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (4E)-2-(4-tert-butylphenyl)-4-(1,3-thiazol-4-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | CC(C)(C)c1ccc(C2=N/C(=C/c3cscn3)C(=O)O2)cc1 |
| InChI | InChI=1S/C17H16N2O2S/c1-17(2,3)12-6-4-11(5-7-12)15-19-14(16(20)21-15)8-13-9-22-10-18-13/h4-10H,1-3H3/b14-8+ |
| InChIKey | ZJCFFZYVLURRLP-RIYZIHGNSA-N |
| XLogP | 3.79 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|