C25H24N2O4S — CID 60607123
4-[(Z)-3-(3-phenylmethoxyphenyl)-2-thiophen-2-ylprop-2-enoyl]morpholine-2-carboxamide (PubChem CID 60607123) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-[(Z)-3-(3-phenylmethoxyphenyl)-2-thiophen-2-ylprop-2-enoyl]morpholine-2-carboxamide.
| Compound Name | 4-[(Z)-3-(3-phenylmethoxyphenyl)-2-thiophen-2-ylprop-2-enoyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 60607123 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[(Z)-3-(3-phenylmethoxyphenyl)-2-thiophen-2-ylprop-2-enoyl]morpholine-2-carboxamide |
| SMILES | NC(=O)C1CN(C(=O)/C(=C/c2cccc(OCc3ccccc3)c2)c2cccs2)CCO1 |
| InChI | InChI=1S/C25H24N2O4S/c26-24(28)22-16-27(11-12-30-22)25(29)21(23-10-5-13-32-23)15-19-8-4-9-20(14-19)31-17-18-6-2-1-3-7-18/h1-10,13-15,22H,11-12,16-17H2,(H2,26,28)/b21-15+ |
| InChIKey | GSSUWEUUGJPMOA-RCCKNPSSSA-N |
| XLogP | 3.58 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|