About N-ethoxy-3,5-difluorobenzenesulfonamide
N-ethoxy-3,5-difluorobenzenesulfonamide (PubChem CID 60700443) has the molecular formula C8H9F2NO3S
and a molecular weight of 237.23 g/mol. Its IUPAC name is N-ethoxy-3,5-difluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-ethoxy-3,5-difluorobenzenesulfonamide |
| PubChem CID | 60700443 |
| Molecular Formula | C8H9F2NO3S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | N-ethoxy-3,5-difluorobenzenesulfonamide |
| SMILES | CCONS(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H9F2NO3S/c1-2-14-11-15(12,13)8-4-6(9)3-7(10)5-8/h3-5,11H,2H2,1H3 |
| InChIKey | YMZJUAPWJSMYGH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-3,5-difluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-3,5-difluorobenzenesulfonamide?
The IUPAC name of N-ethoxy-3,5-difluorobenzenesulfonamide (CID 60700443) is N-ethoxy-3,5-difluorobenzenesulfonamide.
What is the SMILES notation for N-ethoxy-3,5-difluorobenzenesulfonamide?
The canonical SMILES for N-ethoxy-3,5-difluorobenzenesulfonamide is CCONS(=O)(=O)c1cc(F)cc(F)c1.
What is the InChIKey of N-ethoxy-3,5-difluorobenzenesulfonamide?
The InChIKey is YMZJUAPWJSMYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO3S/c1-2-14-11-15(12,13)8-4-6(9)3-7(10)5-8/h3-5,11H,2H2,1H3.
What are the key properties of N-ethoxy-3,5-difluorobenzenesulfonamide?
N-ethoxy-3,5-difluorobenzenesulfonamide has a molecular weight of 237.23 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-3,5-difluorobenzenesulfonamide is sourced from PubChem (CID 60700443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).