C8H9F2NO3S — CID 60700443
N-ethoxy-3,5-difluorobenzenesulfonamide (PubChem CID 60700443) has the molecular formula C8H9F2NO3S and a molecular weight of 237.23 g/mol. Its IUPAC name is N-ethoxy-3,5-difluorobenzenesulfonamide.
| Compound Name | N-ethoxy-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 60700443 |
| Molecular Formula | C8H9F2NO3S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | N-ethoxy-3,5-difluorobenzenesulfonamide |
| SMILES | CCONS(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H9F2NO3S/c1-2-14-11-15(12,13)8-4-6(9)3-7(10)5-8/h3-5,11H,2H2,1H3 |
| InChIKey | YMZJUAPWJSMYGH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|