C15H16N2O2S2 — CID 60804741
N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-4-thiophen-2-ylbutanamide (PubChem CID 60804741) has the molecular formula C15H16N2O2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 60804741 |
| Molecular Formula | C15H16N2O2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)Nc1ncc(C#CCCO)s1 |
| InChI | InChI=1S/C15H16N2O2S2/c18-9-2-1-5-13-11-16-15(21-13)17-14(19)8-3-6-12-7-4-10-20-12/h4,7,10-11,18H,2-3,6,8-9H2,(H,16,17,19) |
| InChIKey | GACKFZIYNMVQIF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|