C18H16N2O — CID 60821445
[4-(3-aminoprop-1-ynyl)phenyl]-(2,3-dihydroindol-1-yl)methanone (PubChem CID 60821445) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is [4-(3-aminoprop-1-ynyl)phenyl]-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | [4-(3-aminoprop-1-ynyl)phenyl]-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 60821445 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [4-(3-aminoprop-1-ynyl)phenyl]-(2,3-dihydroindol-1-yl)methanone |
| SMILES | NCC#Cc1ccc(C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H16N2O/c19-12-3-4-14-7-9-16(10-8-14)18(21)20-13-11-15-5-1-2-6-17(15)20/h1-2,5-10H,11-13,19H2 |
| InChIKey | UFCCWCIMPBYLRX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|