C8H13F2NO4S — CID 60829622
2-[cyclopentyl(difluoromethylsulfonyl)amino]acetic acid (PubChem CID 60829622) has the molecular formula C8H13F2NO4S and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-[cyclopentyl(difluoromethylsulfonyl)amino]acetic acid.
| Compound Name | 2-[cyclopentyl(difluoromethylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 60829622 |
| Molecular Formula | C8H13F2NO4S |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-[cyclopentyl(difluoromethylsulfonyl)amino]acetic acid |
| SMILES | O=C(O)CN(C1CCCC1)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C8H13F2NO4S/c9-8(10)16(14,15)11(5-7(12)13)6-3-1-2-4-6/h6,8H,1-5H2,(H,12,13) |
| InChIKey | ZTLSCJNLJGPUJG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |