C9H14F3NO4S — CID 105360897
2-[cyclopentylsulfonyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 105360897) has the molecular formula C9H14F3NO4S and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-[cyclopentylsulfonyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[cyclopentylsulfonyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 105360897 |
| Molecular Formula | C9H14F3NO4S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-[cyclopentylsulfonyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(F)(F)F)S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C9H14F3NO4S/c10-9(11,12)6-13(5-8(14)15)18(16,17)7-3-1-2-4-7/h7H,1-6H2,(H,14,15) |
| InChIKey | QAEJNPCJBFWSMF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |