C13H16N2O — CID 60869621
N-(1,2-oxazol-4-ylmethyl)-2-propan-2-ylaniline (PubChem CID 60869621) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(1,2-oxazol-4-ylmethyl)-2-propan-2-ylaniline.
| Compound Name | N-(1,2-oxazol-4-ylmethyl)-2-propan-2-ylaniline |
|---|---|
| PubChem CID | 60869621 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(1,2-oxazol-4-ylmethyl)-2-propan-2-ylaniline |
| SMILES | CC(C)c1ccccc1NCc1cnoc1 |
| InChI | InChI=1S/C13H16N2O/c1-10(2)12-5-3-4-6-13(12)14-7-11-8-15-16-9-11/h3-6,8-10,14H,7H2,1-2H3 |
| InChIKey | FMQCHCSNLGEVRJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |