C18H24N2 — CID 6088162
(Z)-3-[4-(dimethylamino)cyclohexyl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 6088162) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (Z)-3-[4-(dimethylamino)cyclohexyl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-(dimethylamino)cyclohexyl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6088162 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (Z)-3-[4-(dimethylamino)cyclohexyl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C(C#N)=C/C2CCC(N(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H24N2/c1-14-4-8-16(9-5-14)17(13-19)12-15-6-10-18(11-7-15)20(2)3/h4-5,8-9,12,15,18H,6-7,10-11H2,1-3H3/b17-12+ |
| InChIKey | SAZSBMMADMRXCH-SFQUDFHCSA-N |
| XLogP | 4.02 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|