C11H10Cl2O6S — CID 60884471
3,5-dichloro-2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzoic acid (PubChem CID 60884471) has the molecular formula C11H10Cl2O6S and a molecular weight of 341.17 g/mol. Its IUPAC name is 3,5-dichloro-2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzoic acid.
| Compound Name | 3,5-dichloro-2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 60884471 |
| Molecular Formula | C11H10Cl2O6S |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 3,5-dichloro-2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(Cl)c1OC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C11H10Cl2O6S/c12-5-1-6(11(15)16)10(7(13)2-5)19-9-4-20(17,18)3-8(9)14/h1-2,8-9,14H,3-4H2,(H,15,16) |
| InChIKey | FPLZZWCAPFHWMR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |