C20H17ClF3N3O3S — CID 6090509
4-[(Z)-N-[2-chloro-5-(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 6090509) has the molecular formula C20H17ClF3N3O3S and a molecular weight of 471.89 g/mol. Its IUPAC name is 4-[(Z)-N-[2-chloro-5-(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-[(Z)-N-[2-chloro-5-(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 6090509 |
| Molecular Formula | C20H17ClF3N3O3S |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 4-[(Z)-N-[2-chloro-5-(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | C/C(=N/Nc1cc(C(F)(F)F)ccc1Cl)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H17ClF3N3O3S/c1-13(26-27-19-11-15(20(22,23)24)6-9-18(19)21)14-4-7-17(8-5-14)31(28,29)25-12-16-3-2-10-30-16/h2-11,25,27H,12H2,1H3/b26-13- |
| InChIKey | XAVMNKGLZYZLRB-ZMFRSBBQSA-N |
| XLogP | 5.27 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|