C10H14N4O — CID 60983297
N-(1H-1,2,4-triazol-5-ylmethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 60983297) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 60983297 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCc1ncn[nH]1)C1CC=CCC1 |
| InChI | InChI=1S/C10H14N4O/c15-10(8-4-2-1-3-5-8)11-6-9-12-7-13-14-9/h1-2,7-8H,3-6H2,(H,11,15)(H,12,13,14) |
| InChIKey | LRZFRDGEDSHVMS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|