C11H14N4O3 — CID 54886020
6-(1H-1,2,4-triazol-5-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 54886020) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 6-(1H-1,2,4-triazol-5-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(1H-1,2,4-triazol-5-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 54886020 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 6-(1H-1,2,4-triazol-5-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C11H14N4O3/c16-10(12-5-9-13-6-14-15-9)7-3-1-2-4-8(7)11(17)18/h1-2,6-8H,3-5H2,(H,12,16)(H,17,18)(H,13,14,15) |
| InChIKey | JSXVYLZYOYEQHC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|