C9H17NO5S — CID 61023571
4-(1,4-dioxan-2-ylmethylamino)-1,1-dioxothiolan-3-ol (PubChem CID 61023571) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is 4-(1,4-dioxan-2-ylmethylamino)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(1,4-dioxan-2-ylmethylamino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 61023571 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-(1,4-dioxan-2-ylmethylamino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NCC2COCCO2)C1 |
| InChI | InChI=1S/C9H17NO5S/c11-9-6-16(12,13)5-8(9)10-3-7-4-14-1-2-15-7/h7-11H,1-6H2 |
| InChIKey | PBSXVCFNRVRFBV-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |