C12H20CuN10S4 — CID 6102420
copper 5-[10-(5-sulfido-1,3,4-thiadiazol-2-yl)-1,3,5,8,10,12-hexazacyclotetradec-3-yl]-1,3,4-thiadiazole-2-thiolate (PubChem CID 6102420) has the molecular formula C12H20CuN10S4 and a molecular weight of 496.18 g/mol. Its IUPAC name is copper 5-[10-(5-sulfido-1,3,4-thiadiazol-2-yl)-1,3,5,8,10,12-hexazacyclotetradec-3-yl]-1,3,4-thiadiazole-2-thiolate.
| Compound Name | copper 5-[10-(5-sulfido-1,3,4-thiadiazol-2-yl)-1,3,5,8,10,12-hexazacyclotetradec-3-yl]-1,3,4-thiadiazole-2-thiolate |
|---|---|
| PubChem CID | 6102420 |
| Molecular Formula | C12H20CuN10S4 |
| Molecular Weight | 496.18 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | copper 5-[10-(5-sulfido-1,3,4-thiadiazol-2-yl)-1,3,5,8,10,12-hexazacyclotetradec-3-yl]-1,3,4-thiadiazole-2-thiolate |
| SMILES | [Cu+2].[S-]c1nnc(N2CNCCNCN(c3nnc([S-])s3)CNCCNC2)s1 |
| InChI | InChI=1S/C12H22N10S4.Cu/c23-11-19-17-9(25-11)21-5-13-1-2-14-6-22(8-16-4-3-15-7-21)10-18-20-12(24)26-10;/h13-16H,1-8H2,(H,19,23)(H,20,24);/q;+2/p-2 |
| InChIKey | INKLOXIGKBQNGG-UHFFFAOYSA-L |
| XLogP | -1.29 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.18 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|