About 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide
3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 61062582) has the molecular formula C11H8BrN5O2S2
and a molecular weight of 386.26 g/mol. Its IUPAC name is 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide |
| PubChem CID | 61062582 |
| Molecular Formula | C11H8BrN5O2S2 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-n2cncn2)nc1)c1sccc1Br |
| InChI | InChI=1S/C11H8BrN5O2S2/c12-9-3-4-20-11(9)21(18,19)16-8-1-2-10(14-5-8)17-7-13-6-15-17/h1-7,16H |
| InChIKey | FTSVYNIPFUVYHT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide?
The IUPAC name of 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide (CID 61062582) is 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide.
What is the SMILES notation for 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide?
The canonical SMILES for 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide is O=S(=O)(Nc1ccc(-n2cncn2)nc1)c1sccc1Br.
What is the InChIKey of 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide?
The InChIKey is FTSVYNIPFUVYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrN5O2S2/c12-9-3-4-20-11(9)21(18,19)16-8-1-2-10(14-5-8)17-7-13-6-15-17/h1-7,16H.
What are the key properties of 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide?
3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide has a molecular weight of 386.26 g/mol, XLogP of 2.29, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]thiophene-2-sulfonamide is sourced from PubChem (CID 61062582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).