C10H20N6O3S — CID 61140200
2-(3-amino-1,2,4-triazol-1-yl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]acetamide (PubChem CID 61140200) has the molecular formula C10H20N6O3S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 61140200 |
| Molecular Formula | C10H20N6O3S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]acetamide |
| SMILES | CCN(CCCNC(=O)Cn1cnc(N)n1)S(C)(=O)=O |
| InChI | InChI=1S/C10H20N6O3S/c1-3-16(20(2,18)19)6-4-5-12-9(17)7-15-8-13-10(11)14-15/h8H,3-7H2,1-2H3,(H2,11,14)(H,12,17) |
| InChIKey | LXOMJVJKOSKYOJ-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|