C8H15N5O — CID 43600686
N-[3-(methylamino)propyl]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 43600686) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[3-(methylamino)propyl]-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 43600686 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | N-[3-(methylamino)propyl]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | CNCCCNC(=O)Cn1cncn1 |
| InChI | InChI=1S/C8H15N5O/c1-9-3-2-4-11-8(14)5-13-7-10-6-12-13/h6-7,9H,2-5H2,1H3,(H,11,14) |
| InChIKey | BJZMZLUQIYQDJC-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|