C15H22N4OS — CID 61205508
N-(3-cyanothiophen-2-yl)-3-[3-(methylaminomethyl)piperidin-1-yl]propanamide (PubChem CID 61205508) has the molecular formula C15H22N4OS and a molecular weight of 306.43 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-3-[3-(methylaminomethyl)piperidin-1-yl]propanamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-3-[3-(methylaminomethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 61205508 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-3-[3-(methylaminomethyl)piperidin-1-yl]propanamide |
| SMILES | CNCC1CCCN(CCC(=O)Nc2sccc2C#N)C1 |
| InChI | InChI=1S/C15H22N4OS/c1-17-10-12-3-2-6-19(11-12)7-4-14(20)18-15-13(9-16)5-8-21-15/h5,8,12,17H,2-4,6-7,10-11H2,1H3,(H,18,20) |
| InChIKey | PAQKZNJPOUYZSA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |