C12H12Cl2N2O2S2 — CID 61298597
4-amino-N-[1-(2,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 61298597) has the molecular formula C12H12Cl2N2O2S2 and a molecular weight of 351.28 g/mol. Its IUPAC name is 4-amino-N-[1-(2,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-[1-(2,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61298597 |
| Molecular Formula | C12H12Cl2N2O2S2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 4-amino-N-[1-(2,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(N)cs1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O2S2/c1-7(10-3-2-8(13)4-11(10)14)16-20(17,18)12-5-9(15)6-19-12/h2-7,16H,15H2,1H3 |
| InChIKey | HPEIQYWTWZWKCA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |