C12H11N3O2S2 — CID 61300772
4-amino-N-[(4-cyanophenyl)methyl]thiophene-2-sulfonamide (PubChem CID 61300772) has the molecular formula C12H11N3O2S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-amino-N-[(4-cyanophenyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-[(4-cyanophenyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61300772 |
| Molecular Formula | C12H11N3O2S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 4-amino-N-[(4-cyanophenyl)methyl]thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(CNS(=O)(=O)c2cc(N)cs2)cc1 |
| InChI | InChI=1S/C12H11N3O2S2/c13-6-9-1-3-10(4-2-9)7-15-19(16,17)12-5-11(14)8-18-12/h1-5,8,15H,7,14H2 |
| InChIKey | BBJHEAJKOSFSFW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |