About (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine
(4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 61330086) has the molecular formula C14H15F3N2OS
and a molecular weight of 316.35 g/mol. Its IUPAC name is (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine.
Molecular Properties
| Compound Name | (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine |
| PubChem CID | 61330086 |
| Molecular Formula | C14H15F3N2OS |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CC(C)c1csc(C(N)c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C14H15F3N2OS/c1-8(2)11-7-21-13(19-11)12(18)9-3-5-10(6-4-9)20-14(15,16)17/h3-8,12H,18H2,1-2H3 |
| InChIKey | KJRQJVKZAYYDON-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine?
The IUPAC name of (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine (CID 61330086) is (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine.
What is the SMILES notation for (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine?
The canonical SMILES for (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine is CC(C)c1csc(C(N)c2ccc(OC(F)(F)F)cc2)n1.
What is the InChIKey of (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine?
The InChIKey is KJRQJVKZAYYDON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2OS/c1-8(2)11-7-21-13(19-11)12(18)9-3-5-10(6-4-9)20-14(15,16)17/h3-8,12H,18H2,1-2H3.
What are the key properties of (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine?
(4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine has a molecular weight of 316.35 g/mol, XLogP of 4.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propan-2-yl-1,3-thiazol-2-yl)-[4-(trifluoromethoxy)phenyl]methanamine is sourced from PubChem (CID 61330086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).