C11H10F5NO3 — CID 61492676
2,2-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzodioxol-5-amine (PubChem CID 61492676) has the molecular formula C11H10F5NO3 and a molecular weight of 299.20 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 61492676 |
| Molecular Formula | C11H10F5NO3 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2,2-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzodioxol-5-amine |
| SMILES | FC(F)(F)COCCNc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C11H10F5NO3/c12-10(13,14)6-18-4-3-17-7-1-2-8-9(5-7)20-11(15,16)19-8/h1-2,5,17H,3-4,6H2 |
| InChIKey | RYJJWSVRRASCMO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|