C18H21NO2 — CID 6166068
(3E)-3-(5-tert-butyl-2-oxocyclohexylidene)-1H-indol-2-one (PubChem CID 6166068) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3E)-3-(5-tert-butyl-2-oxocyclohexylidene)-1H-indol-2-one.
| Compound Name | (3E)-3-(5-tert-butyl-2-oxocyclohexylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 6166068 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3E)-3-(5-tert-butyl-2-oxocyclohexylidene)-1H-indol-2-one |
| SMILES | CC(C)(C)C1CCC(=O)/C(=C2/C(=O)Nc3ccccc32)C1 |
| InChI | InChI=1S/C18H21NO2/c1-18(2,3)11-8-9-15(20)13(10-11)16-12-6-4-5-7-14(12)19-17(16)21/h4-7,11H,8-10H2,1-3H3,(H,19,21)/b16-13+ |
| InChIKey | RADJTGBBYWHASX-DTQAZKPQSA-N |
| XLogP | 3.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|