C17H14N2O — CID 10199133
(3Z)-3-(5-amino-2,3-dihydroinden-1-ylidene)-1H-indol-2-one (PubChem CID 10199133) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is (3Z)-3-(5-amino-2,3-dihydroinden-1-ylidene)-1H-indol-2-one.
| Compound Name | (3Z)-3-(5-amino-2,3-dihydroinden-1-ylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 10199133 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (3Z)-3-(5-amino-2,3-dihydroinden-1-ylidene)-1H-indol-2-one |
| SMILES | Nc1ccc2c(c1)CC/C2=C1/C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C17H14N2O/c18-11-6-8-12-10(9-11)5-7-13(12)16-14-3-1-2-4-15(14)19-17(16)20/h1-4,6,8-9H,5,7,18H2,(H,19,20)/b16-13- |
| InChIKey | RPHHWCDNPQGDJA-SSZFMOIBSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|