C16H16N2O3 — CID 6177645
(7E)-7-benzylidene-1-(2-hydroxyethyl)-5,6-dihydro-2H-cyclopenta[c]pyridazine-3,4-dione (PubChem CID 6177645) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is (7E)-7-benzylidene-1-(2-hydroxyethyl)-5,6-dihydro-2H-cyclopenta[c]pyridazine-3,4-dione.
| Compound Name | (7E)-7-benzylidene-1-(2-hydroxyethyl)-5,6-dihydro-2H-cyclopenta[c]pyridazine-3,4-dione |
|---|---|
| PubChem CID | 6177645 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (7E)-7-benzylidene-1-(2-hydroxyethyl)-5,6-dihydro-2H-cyclopenta[c]pyridazine-3,4-dione |
| SMILES | O=c1[nH]n(CCO)c2c(c1=O)CC/C2=C\c1ccccc1 |
| InChI | InChI=1S/C16H16N2O3/c19-9-8-18-14-12(10-11-4-2-1-3-5-11)6-7-13(14)15(20)16(21)17-18/h1-5,10,19H,6-9H2,(H,17,21)/b12-10+ |
| InChIKey | LBGFNWRTDDDLHP-ZRDIBKRKSA-N |
| XLogP | 1.02 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|