C30H29BrN2O3 — CID 6184658
(E)-3-[5-bromo-2-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 6184658) has the molecular formula C30H29BrN2O3 and a molecular weight of 545.48 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6184658 |
| Molecular Formula | C30H29BrN2O3 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | (E)-3-[5-bromo-2-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)ccc1OCCOc1ccc(C2CCCCC2)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H29BrN2O3/c31-26-13-16-29(24(20-26)19-25(21-32)30(34)33-27-9-5-2-6-10-27)36-18-17-35-28-14-11-23(12-15-28)22-7-3-1-4-8-22/h2,5-6,9-16,19-20,22H,1,3-4,7-8,17-18H2,(H,33,34)/b25-19+ |
| InChIKey | QNAYHCCFOUCSBW-NCELDCMTSA-N |
| XLogP | 7.50 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|