C26H33O5PS — CID 618689
diphenyl-[2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methylsulfanyl]ethyl]phosphane (PubChem CID 618689) has the molecular formula C26H33O5PS and a molecular weight of 488.59 g/mol. Its IUPAC name is diphenyl-[2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methylsulfanyl]ethyl]phosphane.
| Compound Name | diphenyl-[2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methylsulfanyl]ethyl]phosphane |
|---|---|
| PubChem CID | 618689 |
| Molecular Formula | C26H33O5PS |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | diphenyl-[2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methylsulfanyl]ethyl]phosphane |
| SMILES | CC1(C)OC2OC(CSCCP(c3ccccc3)c3ccccc3)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C26H33O5PS/c1-25(2)28-21-20(27-24-23(22(21)29-25)30-26(3,4)31-24)17-33-16-15-32(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-24H,15-17H2,1-4H3 |
| InChIKey | LKCWROYJYOJHEQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|