C8H7Cl2NO — CID 6193980
1-(2,6-dichlorophenyl)-N-methylmethanimine oxide (PubChem CID 6193980) has the molecular formula C8H7Cl2NO and a molecular weight of 204.06 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-methylmethanimine oxide.
| Compound Name | 1-(2,6-dichlorophenyl)-N-methylmethanimine oxide |
|---|---|
| PubChem CID | 6193980 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-methylmethanimine oxide |
| SMILES | C/[N+]([O-])=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H7Cl2NO/c1-11(12)5-6-7(9)3-2-4-8(6)10/h2-5H,1H3/b11-5- |
| InChIKey | RXESCSNMPGYWQQ-WZUFQYTHSA-N |
| XLogP | 2.55 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|