C12H10O4S — CID 619544
2-hydroxy-5-methoxy-3-(thiophen-2-ylmethyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 619544) has the molecular formula C12H10O4S and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-hydroxy-5-methoxy-3-(thiophen-2-ylmethyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-hydroxy-5-methoxy-3-(thiophen-2-ylmethyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 619544 |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-hydroxy-5-methoxy-3-(thiophen-2-ylmethyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=CC(=O)C(O)=C(Cc2cccs2)C1=O |
| InChI | InChI=1S/C12H10O4S/c1-16-10-6-9(13)11(14)8(12(10)15)5-7-3-2-4-17-7/h2-4,6,14H,5H2,1H3 |
| InChIKey | RTSLDCILHRFDTL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|