C18H12ClN3 — CID 6195991
(Z)-2-(4-chlorophenyl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile (PubChem CID 6195991) has the molecular formula C18H12ClN3 and a molecular weight of 305.77 g/mol. Its IUPAC name is (Z)-2-(4-chlorophenyl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-chlorophenyl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6195991 |
| Molecular Formula | C18H12ClN3 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (Z)-2-(4-chlorophenyl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn[nH]c1-c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12ClN3/c19-17-8-6-13(7-9-17)15(11-20)10-16-12-21-22-18(16)14-4-2-1-3-5-14/h1-10,12H,(H,21,22)/b15-10+ |
| InChIKey | AQHWPUKVXVDPEV-XNTDXEJSSA-N |
| XLogP | 4.79 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|