C22H14N4O2S — CID 6196413
(E)-3-[1-(4-nitrophenyl)pyrrol-2-yl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 6196413) has the molecular formula C22H14N4O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is (E)-3-[1-(4-nitrophenyl)pyrrol-2-yl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[1-(4-nitrophenyl)pyrrol-2-yl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6196413 |
| Molecular Formula | C22H14N4O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (E)-3-[1-(4-nitrophenyl)pyrrol-2-yl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cccn1-c1ccc([N+](=O)[O-])cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H14N4O2S/c23-14-17(22-24-21(15-29-22)16-5-2-1-3-6-16)13-20-7-4-12-25(20)18-8-10-19(11-9-18)26(27)28/h1-13,15H/b17-13+ |
| InChIKey | QVPHLXGFVUCULT-GHRIWEEISA-N |
| XLogP | 5.57 |
| TPSA | 84.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_G(1)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|