C14H20FNO4 — CID 62029375
1-[5-fluoro-2-hydroxy-3-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]phenyl]ethanone (PubChem CID 62029375) has the molecular formula C14H20FNO4 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-[5-fluoro-2-hydroxy-3-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]phenyl]ethanone.
| Compound Name | 1-[5-fluoro-2-hydroxy-3-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 62029375 |
| Molecular Formula | C14H20FNO4 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-[5-fluoro-2-hydroxy-3-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]phenyl]ethanone |
| SMILES | COCC(O)CN(C)Cc1cc(F)cc(C(C)=O)c1O |
| InChI | InChI=1S/C14H20FNO4/c1-9(17)13-5-11(15)4-10(14(13)19)6-16(2)7-12(18)8-20-3/h4-5,12,18-19H,6-8H2,1-3H3 |
| InChIKey | WSRHVKFQTNRWIY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|