C11H13N3O — CID 62082072
(5-ethyl-1H-1,2,4-triazol-3-yl)-phenylmethanol (PubChem CID 62082072) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is (5-ethyl-1H-1,2,4-triazol-3-yl)-phenylmethanol.
| Compound Name | (5-ethyl-1H-1,2,4-triazol-3-yl)-phenylmethanol |
|---|---|
| PubChem CID | 62082072 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (5-ethyl-1H-1,2,4-triazol-3-yl)-phenylmethanol |
| SMILES | CCc1nc(C(O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C11H13N3O/c1-2-9-12-11(14-13-9)10(15)8-6-4-3-5-7-8/h3-7,10,15H,2H2,1H3,(H,12,13,14) |
| InChIKey | CGSIBLSWHVCEML-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |