C20H18N4O3S — CID 6215674
N-[(Z)-[2-(1,3-benzoxazol-2-ylsulfanyl)cyclohexen-1-yl]methylideneamino]-4-nitroaniline (PubChem CID 6215674) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is N-[(Z)-[2-(1,3-benzoxazol-2-ylsulfanyl)cyclohexen-1-yl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[(Z)-[2-(1,3-benzoxazol-2-ylsulfanyl)cyclohexen-1-yl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 6215674 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[(Z)-[2-(1,3-benzoxazol-2-ylsulfanyl)cyclohexen-1-yl]methylideneamino]-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\C2=C(Sc3nc4ccccc4o3)CCCC2)cc1 |
| InChI | InChI=1S/C20H18N4O3S/c25-24(26)16-11-9-15(10-12-16)23-21-13-14-5-1-4-8-19(14)28-20-22-17-6-2-3-7-18(17)27-20/h2-3,6-7,9-13,23H,1,4-5,8H2/b21-13- |
| InChIKey | AETNYAKHMBXEPL-BKUYFWCQSA-N |
| XLogP | 5.75 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|