C13H10N4O3S — CID 80924012
[3-(1,3-benzoxazol-2-ylsulfanyl)-2-nitrophenyl]hydrazine (PubChem CID 80924012) has the molecular formula C13H10N4O3S and a molecular weight of 302.31 g/mol. Its IUPAC name is [3-(1,3-benzoxazol-2-ylsulfanyl)-2-nitrophenyl]hydrazine.
| Compound Name | [3-(1,3-benzoxazol-2-ylsulfanyl)-2-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 80924012 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [3-(1,3-benzoxazol-2-ylsulfanyl)-2-nitrophenyl]hydrazine |
| SMILES | NNc1cccc(Sc2nc3ccccc3o2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10N4O3S/c14-16-9-5-3-7-11(12(9)17(18)19)21-13-15-8-4-1-2-6-10(8)20-13/h1-7,16H,14H2 |
| InChIKey | LPEUFLCWYRZCMA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|