C33H35N3O9S2 — CID 6219972
N-[2-[(5E)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(4-ethoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 6219972) has the molecular formula C33H35N3O9S2 and a molecular weight of 681.79 g/mol. Its IUPAC name is N-[2-[(5E)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(4-ethoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-[2-[(5E)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(4-ethoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 6219972 |
| Molecular Formula | C33H35N3O9S2 |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | N-[2-[(5E)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(4-ethoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2Cc3ccccc3CC2C(=O)NCCN2C(=O)S/C(=C/c3cc(OC)c(OC)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C33H35N3O9S2/c1-5-45-24-10-12-25(13-11-24)47(40,41)36-20-23-9-7-6-8-22(23)19-26(36)31(37)34-14-15-35-32(38)29(46-33(35)39)18-21-16-27(42-2)30(44-4)28(17-21)43-3/h6-13,16-18,26H,5,14-15,19-20H2,1-4H3,(H,34,37)/b29-18+ |
| InChIKey | AWOIHYINOZCJMO-RDRPBHBLSA-N |
| XLogP | 4.08 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|