C26H22N4O7S3 — CID 6515414
N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-(2-nitrophenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 6515414) has the molecular formula C26H22N4O7S3 and a molecular weight of 598.68 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-(2-nitrophenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-(2-nitrophenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 6515414 |
| Molecular Formula | C26H22N4O7S3 |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-(2-nitrophenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2cccs2)C1=O)C1Cc2ccccc2CN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H22N4O7S3/c31-24(27-11-12-28-25(32)22(39-26(28)33)15-19-8-5-13-38-19)21-14-17-6-1-2-7-18(17)16-29(21)40(36,37)23-10-4-3-9-20(23)30(34)35/h1-10,13,15,21H,11-12,14,16H2,(H,27,31)/b22-15- |
| InChIKey | OGIHWINKVPQSSY-JCMHNJIXSA-N |
| XLogP | 3.62 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|