C10H13N5O3S — CID 62209214
1-methyl-3-[[5-(propylamino)thiadiazol-4-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 62209214) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is 1-methyl-3-[[5-(propylamino)thiadiazol-4-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-methyl-3-[[5-(propylamino)thiadiazol-4-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 62209214 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 1-methyl-3-[[5-(propylamino)thiadiazol-4-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | CCCNc1snnc1CN1C(=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C10H13N5O3S/c1-3-4-11-7-6(12-13-19-7)5-15-9(17)8(16)14(2)10(15)18/h11H,3-5H2,1-2H3 |
| InChIKey | UUAGJHRIIFWMLZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|